About (3S)-1-N,1-N-diethyl-4-methylidenehexane-1,3-diamine
(3S)-1-N,1-N-diethyl-4-methylidenehexane-1,3-diamine (PubChem CID 88995207) has the molecular formula C11H24N2
and a molecular weight of 184.33 g/mol. Its IUPAC name is (3S)-1-N,1-N-diethyl-4-methylidenehexane-1,3-diamine.
Molecular Properties
| Compound Name | (3S)-1-N,1-N-diethyl-4-methylidenehexane-1,3-diamine |
| PubChem CID | 88995207 |
| Molecular Formula | C11H24N2 |
| Molecular Weight | 184.33 g/mol |
| Exact Mass | 184.19 |
| IUPAC Name | (3S)-1-N,1-N-diethyl-4-methylidenehexane-1,3-diamine |
| SMILES | C=C(CC)[C@@H](N)CCN(CC)CC |
| InChI | InChI=1S/C11H24N2/c1-5-10(4)11(12)8-9-13(6-2)7-3/h11H,4-9,12H2,1-3H3/t11-/m0/s1 |
| InChIKey | BHCODMGRGIHFAD-NSHDSACASA-N |
| XLogP | 2.01 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.33 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3S)-1-N,1-N-diethyl-4-methylidenehexane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-1-N,1-N-diethyl-4-methylidenehexane-1,3-diamine?
The IUPAC name of (3S)-1-N,1-N-diethyl-4-methylidenehexane-1,3-diamine (CID 88995207) is (3S)-1-N,1-N-diethyl-4-methylidenehexane-1,3-diamine.
What is the SMILES notation for (3S)-1-N,1-N-diethyl-4-methylidenehexane-1,3-diamine?
The canonical SMILES for (3S)-1-N,1-N-diethyl-4-methylidenehexane-1,3-diamine is C=C(CC)[C@@H](N)CCN(CC)CC.
What is the InChIKey of (3S)-1-N,1-N-diethyl-4-methylidenehexane-1,3-diamine?
The InChIKey is BHCODMGRGIHFAD-NSHDSACASA-N. The full InChI is InChI=1S/C11H24N2/c1-5-10(4)11(12)8-9-13(6-2)7-3/h11H,4-9,12H2,1-3H3/t11-/m0/s1.
What are the key properties of (3S)-1-N,1-N-diethyl-4-methylidenehexane-1,3-diamine?
(3S)-1-N,1-N-diethyl-4-methylidenehexane-1,3-diamine has a molecular weight of 184.33 g/mol, XLogP of 2.01, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-1-N,1-N-diethyl-4-methylidenehexane-1,3-diamine is sourced from PubChem (CID 88995207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).