About 6-ethyl-3-methyl-2,3-dihydro-1H-indole
6-ethyl-3-methyl-2,3-dihydro-1H-indole (PubChem CID 88995229) has the molecular formula C11H15N
and a molecular weight of 161.25 g/mol. Its IUPAC name is 6-ethyl-3-methyl-2,3-dihydro-1H-indole.
Molecular Properties
| Compound Name | 6-ethyl-3-methyl-2,3-dihydro-1H-indole |
| PubChem CID | 88995229 |
| Molecular Formula | C11H15N |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | 6-ethyl-3-methyl-2,3-dihydro-1H-indole |
| SMILES | CCc1ccc2c(c1)NCC2C |
| InChI | InChI=1S/C11H15N/c1-3-9-4-5-10-8(2)7-12-11(10)6-9/h4-6,8,12H,3,7H2,1-2H3 |
| InChIKey | SLTOVZQIHGQCDE-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-ethyl-3-methyl-2,3-dihydro-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethyl-3-methyl-2,3-dihydro-1H-indole?
The IUPAC name of 6-ethyl-3-methyl-2,3-dihydro-1H-indole (CID 88995229) is 6-ethyl-3-methyl-2,3-dihydro-1H-indole.
What is the SMILES notation for 6-ethyl-3-methyl-2,3-dihydro-1H-indole?
The canonical SMILES for 6-ethyl-3-methyl-2,3-dihydro-1H-indole is CCc1ccc2c(c1)NCC2C.
What is the InChIKey of 6-ethyl-3-methyl-2,3-dihydro-1H-indole?
The InChIKey is SLTOVZQIHGQCDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N/c1-3-9-4-5-10-8(2)7-12-11(10)6-9/h4-6,8,12H,3,7H2,1-2H3.
What are the key properties of 6-ethyl-3-methyl-2,3-dihydro-1H-indole?
6-ethyl-3-methyl-2,3-dihydro-1H-indole has a molecular weight of 161.25 g/mol, XLogP of 2.78, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethyl-3-methyl-2,3-dihydro-1H-indole is sourced from PubChem (CID 88995229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).