C23H24N4O5 — CID 88995325
2-[(12S)-2,11-dioxo-13-oxa-3,10,19-triazatetracyclo[16.7.0.04,9.020,25]pentacosa-1(18),4,6,8,20,22,24-heptaen-12-yl]-N-hydroxyacetamide (PubChem CID 88995325) has the molecular formula C23H24N4O5 and a molecular weight of 436.47 g/mol. Its IUPAC name is 2-[(12S)-2,11-dioxo-13-oxa-3,10,19-triazatetracyclo[16.7.0.04,9.020,25]pentacosa-1(18),4,6,8,20,22,24-heptaen-12-yl]-N-hydroxyacetamide.
| Compound Name | 2-[(12S)-2,11-dioxo-13-oxa-3,10,19-triazatetracyclo[16.7.0.04,9.020,25]pentacosa-1(18),4,6,8,20,22,24-heptaen-12-yl]-N-hydroxyacetamide |
|---|---|
| PubChem CID | 88995325 |
| Molecular Formula | C23H24N4O5 |
| Molecular Weight | 436.47 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | 2-[(12S)-2,11-dioxo-13-oxa-3,10,19-triazatetracyclo[16.7.0.04,9.020,25]pentacosa-1(18),4,6,8,20,22,24-heptaen-12-yl]-N-hydroxyacetamide |
| SMILES | O=C(C[C@@H]1OCCCCc2[nH]c3ccccc3c2C(=O)Nc2ccccc2NC1=O)NO |
| InChI | InChI=1S/C23H24N4O5/c28-20(27-31)13-19-22(29)25-16-9-3-4-10-17(16)26-23(30)21-14-7-1-2-8-15(14)24-18(21)11-5-6-12-32-19/h1-4,7-10,19,24,31H,5-6,11-13H2,(H,25,29)(H,26,30)(H,27,28)/t19-/m0/s1 |
| InChIKey | XPLYFZSYBWXLDX-IBGZPJMESA-N |
| XLogP | 2.98 |
| TPSA | 132.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.47 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|