About (5-fluoroindazol-1-yl) acetate
(5-fluoroindazol-1-yl) acetate (PubChem CID 88995678) has the molecular formula C9H7FN2O2
and a molecular weight of 194.16 g/mol. Its IUPAC name is (5-fluoroindazol-1-yl) acetate.
Molecular Properties
| Compound Name | (5-fluoroindazol-1-yl) acetate |
| PubChem CID | 88995678 |
| Molecular Formula | C9H7FN2O2 |
| Molecular Weight | 194.16 g/mol |
| Exact Mass | 194.05 |
| IUPAC Name | (5-fluoroindazol-1-yl) acetate |
| SMILES | CC(=O)On1ncc2cc(F)ccc21 |
| InChI | InChI=1S/C9H7FN2O2/c1-6(13)14-12-9-3-2-8(10)4-7(9)5-11-12/h2-5H,1H3 |
| InChIKey | URVCDMDMCPKSFL-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.16 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (5-fluoroindazol-1-yl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-fluoroindazol-1-yl) acetate?
The IUPAC name of (5-fluoroindazol-1-yl) acetate (CID 88995678) is (5-fluoroindazol-1-yl) acetate.
What is the SMILES notation for (5-fluoroindazol-1-yl) acetate?
The canonical SMILES for (5-fluoroindazol-1-yl) acetate is CC(=O)On1ncc2cc(F)ccc21.
What is the InChIKey of (5-fluoroindazol-1-yl) acetate?
The InChIKey is URVCDMDMCPKSFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7FN2O2/c1-6(13)14-12-9-3-2-8(10)4-7(9)5-11-12/h2-5H,1H3.
What are the key properties of (5-fluoroindazol-1-yl) acetate?
(5-fluoroindazol-1-yl) acetate has a molecular weight of 194.16 g/mol, XLogP of 1.15, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5-fluoroindazol-1-yl) acetate is sourced from PubChem (CID 88995678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).