About bis(1-methylcyclopropyl) carbonate
bis(1-methylcyclopropyl) carbonate (PubChem CID 88996166) has the molecular formula C9H14O3
and a molecular weight of 170.21 g/mol. Its IUPAC name is bis(1-methylcyclopropyl) carbonate.
Molecular Properties
| Compound Name | bis(1-methylcyclopropyl) carbonate |
| PubChem CID | 88996166 |
| Molecular Formula | C9H14O3 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | bis(1-methylcyclopropyl) carbonate |
| SMILES | CC1(OC(=O)OC2(C)CC2)CC1 |
| InChI | InChI=1S/C9H14O3/c1-8(3-4-8)11-7(10)12-9(2)5-6-9/h3-6H2,1-2H3 |
| InChIKey | SCAAKHHDRLYICS-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze bis(1-methylcyclopropyl) carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(1-methylcyclopropyl) carbonate?
The IUPAC name of bis(1-methylcyclopropyl) carbonate (CID 88996166) is bis(1-methylcyclopropyl) carbonate.
What is the SMILES notation for bis(1-methylcyclopropyl) carbonate?
The canonical SMILES for bis(1-methylcyclopropyl) carbonate is CC1(OC(=O)OC2(C)CC2)CC1.
What is the InChIKey of bis(1-methylcyclopropyl) carbonate?
The InChIKey is SCAAKHHDRLYICS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O3/c1-8(3-4-8)11-7(10)12-9(2)5-6-9/h3-6H2,1-2H3.
What are the key properties of bis(1-methylcyclopropyl) carbonate?
bis(1-methylcyclopropyl) carbonate has a molecular weight of 170.21 g/mol, XLogP of 2.24, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for bis(1-methylcyclopropyl) carbonate is sourced from PubChem (CID 88996166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).