C60H58F6N12O2 — CID 88996442
N-[4-[[(3R)-3-(dimethylamino)pyrrolidin-1-yl]methyl]-3-(trifluoromethyl)phenyl]-3-(2-imidazo[1,2-b]pyridazin-3-ylethynyl)-4-methylbenzamide (PubChem CID 88996442) has the molecular formula C60H58F6N12O2 and a molecular weight of 1093.19 g/mol. Its IUPAC name is N-[4-[[(3R)-3-(dimethylamino)pyrrolidin-1-yl]methyl]-3-(trifluoromethyl)phenyl]-3-(2-imidazo[1,2-b]pyridazin-3-ylethynyl)-4-methylbenzamide.
| Compound Name | N-[4-[[(3R)-3-(dimethylamino)pyrrolidin-1-yl]methyl]-3-(trifluoromethyl)phenyl]-3-(2-imidazo[1,2-b]pyridazin-3-ylethynyl)-4-methylbenzamide |
|---|---|
| PubChem CID | 88996442 |
| Molecular Formula | C60H58F6N12O2 |
| Molecular Weight | 1093.19 g/mol |
| Exact Mass | 1092.47 |
| IUPAC Name | N-[4-[[(3R)-3-(dimethylamino)pyrrolidin-1-yl]methyl]-3-(trifluoromethyl)phenyl]-3-(2-imidazo[1,2-b]pyridazin-3-ylethynyl)-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)Nc2ccc(CN3CC[C@@H](N(C)C)C3)c(C(F)(F)F)c2)cc1C#Cc1cnc2cccnn12.Cc1ccc(C(=O)Nc2ccc(CN3CC[C@@H](N(C)C)C3)c(C(F)(F)F)c2)cc1C#Cc1cnc2cccnn12 |
| InChI | InChI=1S/2C30H29F3N6O/c2*1-20-6-7-22(15-21(20)9-11-25-17-34-28-5-4-13-35-39(25)28)29(40)36-24-10-8-23(27(16-24)30(31,32)33)18-38-14-12-26(19-38)37(2)3/h2*4-8,10,13,15-17,26H,12,14,18-19H2,1-3H3,(H,36,40)/t2*26-/m11/s1 |
| InChIKey | PXDNYNPLVILVKF-YUPNRWLYSA-N |
| XLogP | 9.69 |
| TPSA | 131.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 80 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1093.19 |
| LogP ≤ 5 | 9.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|