C24H40ClN2O9P — CID 88996821
[[(E)-4-(5-chloro-2,4-dioxopyrimidin-1-yl)but-2-enyl]-[3-(2,4,4-trimethylpentan-2-yloxy)propoxy]phosphoryl]oxymethyl propan-2-yl carbonate (PubChem CID 88996821) has the molecular formula C24H40ClN2O9P and a molecular weight of 567.02 g/mol. Its IUPAC name is [[(E)-4-(5-chloro-2,4-dioxopyrimidin-1-yl)but-2-enyl]-[3-(2,4,4-trimethylpentan-2-yloxy)propoxy]phosphoryl]oxymethyl propan-2-yl carbonate.
| Compound Name | [[(E)-4-(5-chloro-2,4-dioxopyrimidin-1-yl)but-2-enyl]-[3-(2,4,4-trimethylpentan-2-yloxy)propoxy]phosphoryl]oxymethyl propan-2-yl carbonate |
|---|---|
| PubChem CID | 88996821 |
| Molecular Formula | C24H40ClN2O9P |
| Molecular Weight | 567.02 g/mol |
| Exact Mass | 566.22 |
| IUPAC Name | [[(E)-4-(5-chloro-2,4-dioxopyrimidin-1-yl)but-2-enyl]-[3-(2,4,4-trimethylpentan-2-yloxy)propoxy]phosphoryl]oxymethyl propan-2-yl carbonate |
| SMILES | CC(C)OC(=O)OCOP(=O)(C/C=C/Cn1cc(Cl)c(=O)[nH]c1=O)OCCCOC(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C24H40ClN2O9P/c1-18(2)36-22(30)32-17-35-37(31,34-13-10-12-33-24(6,7)16-23(3,4)5)14-9-8-11-27-15-19(25)20(28)26-21(27)29/h8-9,15,18H,10-14,16-17H2,1-7H3,(H,26,28,29)/b9-8+ |
| InChIKey | LEYMOMLDOGUIQB-CMDGGOBGSA-N |
| XLogP | 5.11 |
| TPSA | 135.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.02 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|