C18H21ClF2N6OS — CID 88996826
1-[5-[(1Z,3E)-1-aminohexa-1,3,5-trien-3-yl]-4-methyl-1,3-thiazol-2-yl]-3-[2-[5-chloro-1-(2,2-difluoroethyl)imidazol-4-yl]ethyl]urea (PubChem CID 88996826) has the molecular formula C18H21ClF2N6OS and a molecular weight of 442.92 g/mol. Its IUPAC name is 1-[5-[(1Z,3E)-1-aminohexa-1,3,5-trien-3-yl]-4-methyl-1,3-thiazol-2-yl]-3-[2-[5-chloro-1-(2,2-difluoroethyl)imidazol-4-yl]ethyl]urea.
| Compound Name | 1-[5-[(1Z,3E)-1-aminohexa-1,3,5-trien-3-yl]-4-methyl-1,3-thiazol-2-yl]-3-[2-[5-chloro-1-(2,2-difluoroethyl)imidazol-4-yl]ethyl]urea |
|---|---|
| PubChem CID | 88996826 |
| Molecular Formula | C18H21ClF2N6OS |
| Molecular Weight | 442.92 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | 1-[5-[(1Z,3E)-1-aminohexa-1,3,5-trien-3-yl]-4-methyl-1,3-thiazol-2-yl]-3-[2-[5-chloro-1-(2,2-difluoroethyl)imidazol-4-yl]ethyl]urea |
| SMILES | C=C/C=C(\C=C/N)c1sc(NC(=O)NCCc2ncn(CC(F)F)c2Cl)nc1C |
| InChI | InChI=1S/C18H21ClF2N6OS/c1-3-4-12(5-7-22)15-11(2)25-18(29-15)26-17(28)23-8-6-13-16(19)27(10-24-13)9-14(20)21/h3-5,7,10,14H,1,6,8-9,22H2,2H3,(H2,23,25,26,28)/b7-5-,12-4+ |
| InChIKey | DKFBFPTYVAGEIO-NIZDWENVSA-N |
| XLogP | 3.97 |
| TPSA | 97.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.92 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|