C31H32N2 — CID 88996884
(6Z)-4,4-dimethyl-5-methylidene-14-N-(4-methylphenyl)tetracyclo[11.8.0.03,11.015,20]henicosa-1(21),2,6,11,13,15,17,19-octaene-14,21-diamine (PubChem CID 88996884) has the molecular formula C31H32N2 and a molecular weight of 432.61 g/mol. Its IUPAC name is (6Z)-4,4-dimethyl-5-methylidene-14-N-(4-methylphenyl)tetracyclo[11.8.0.03,11.015,20]henicosa-1(21),2,6,11,13,15,17,19-octaene-14,21-diamine.
| Compound Name | (6Z)-4,4-dimethyl-5-methylidene-14-N-(4-methylphenyl)tetracyclo[11.8.0.03,11.015,20]henicosa-1(21),2,6,11,13,15,17,19-octaene-14,21-diamine |
|---|---|
| PubChem CID | 88996884 |
| Molecular Formula | C31H32N2 |
| Molecular Weight | 432.61 g/mol |
| Exact Mass | 432.26 |
| IUPAC Name | (6Z)-4,4-dimethyl-5-methylidene-14-N-(4-methylphenyl)tetracyclo[11.8.0.03,11.015,20]henicosa-1(21),2,6,11,13,15,17,19-octaene-14,21-diamine |
| SMILES | C=C1/C=C\CCCc2cc3c(Nc4ccc(C)cc4)c4ccccc4c(N)c3cc2C1(C)C |
| InChI | InChI=1S/C31H32N2/c1-20-14-16-23(17-15-20)33-30-25-13-9-8-12-24(25)29(32)26-19-28-22(18-27(26)30)11-7-5-6-10-21(2)31(28,3)4/h6,8-10,12-19,33H,2,5,7,11,32H2,1,3-4H3/b10-6- |
| InChIKey | YKOUSFXLULSZFX-POHAHGRESA-N |
| XLogP | 8.35 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.61 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diaminobenzene_3', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|