C50H47N3 — CID 88996951
14-N-(1,2-dihydroquinolin-6-yl)-10,10-dimethyl-14-N,21-N-bis(4-propan-2-ylphenyl)pentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(21),2,4,6,8,11,13,15,17,19-decaene-14,21-diamine (PubChem CID 88996951) has the molecular formula C50H47N3 and a molecular weight of 689.95 g/mol. Its IUPAC name is 14-N-(1,2-dihydroquinolin-6-yl)-10,10-dimethyl-14-N,21-N-bis(4-propan-2-ylphenyl)pentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(21),2,4,6,8,11,13,15,17,19-decaene-14,21-diamine.
| Compound Name | 14-N-(1,2-dihydroquinolin-6-yl)-10,10-dimethyl-14-N,21-N-bis(4-propan-2-ylphenyl)pentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(21),2,4,6,8,11,13,15,17,19-decaene-14,21-diamine |
|---|---|
| PubChem CID | 88996951 |
| Molecular Formula | C50H47N3 |
| Molecular Weight | 689.95 g/mol |
| Exact Mass | 689.38 |
| IUPAC Name | 14-N-(1,2-dihydroquinolin-6-yl)-10,10-dimethyl-14-N,21-N-bis(4-propan-2-ylphenyl)pentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(21),2,4,6,8,11,13,15,17,19-decaene-14,21-diamine |
| SMILES | CC(C)c1ccc(Nc2c3ccccc3c(N(c3ccc(C(C)C)cc3)c3ccc4c(c3)C=CCN4)c3cc4c(cc23)-c2ccccc2C4(C)C)cc1 |
| InChI | InChI=1S/C50H47N3/c1-31(2)33-17-21-36(22-18-33)52-48-40-14-7-8-15-41(40)49(44-30-46-42(29-43(44)48)39-13-9-10-16-45(39)50(46,5)6)53(37-23-19-34(20-24-37)32(3)4)38-25-26-47-35(28-38)12-11-27-51-47/h7-26,28-32,51-52H,27H2,1-6H3 |
| InChIKey | RUORMVPEBOHFGP-UHFFFAOYSA-N |
| XLogP | 14.20 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.95 |
| LogP ≤ 5 | 14.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diaminobenzene_3', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|