About 3-[(3Z,5Z)-hepta-3,5-dien-2-yl]aniline
3-[(3Z,5Z)-hepta-3,5-dien-2-yl]aniline (PubChem CID 88997026) has the molecular formula C13H17N
and a molecular weight of 187.29 g/mol. Its IUPAC name is 3-[(3Z,5Z)-hepta-3,5-dien-2-yl]aniline.
Molecular Properties
| Compound Name | 3-[(3Z,5Z)-hepta-3,5-dien-2-yl]aniline |
| PubChem CID | 88997026 |
| Molecular Formula | C13H17N |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | 3-[(3Z,5Z)-hepta-3,5-dien-2-yl]aniline |
| SMILES | C/C=C\C=C/C(C)c1cccc(N)c1 |
| InChI | InChI=1S/C13H17N/c1-3-4-5-7-11(2)12-8-6-9-13(14)10-12/h3-11H,14H2,1-2H3/b4-3-,7-5- |
| InChIKey | OFQAMVLHKSPICP-MRWCJKGFSA-N |
| XLogP | 3.50 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3-[(3Z,5Z)-hepta-3,5-dien-2-yl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3Z,5Z)-hepta-3,5-dien-2-yl]aniline?
The IUPAC name of 3-[(3Z,5Z)-hepta-3,5-dien-2-yl]aniline (CID 88997026) is 3-[(3Z,5Z)-hepta-3,5-dien-2-yl]aniline.
What is the SMILES notation for 3-[(3Z,5Z)-hepta-3,5-dien-2-yl]aniline?
The canonical SMILES for 3-[(3Z,5Z)-hepta-3,5-dien-2-yl]aniline is C/C=C\C=C/C(C)c1cccc(N)c1.
What is the InChIKey of 3-[(3Z,5Z)-hepta-3,5-dien-2-yl]aniline?
The InChIKey is OFQAMVLHKSPICP-MRWCJKGFSA-N. The full InChI is InChI=1S/C13H17N/c1-3-4-5-7-11(2)12-8-6-9-13(14)10-12/h3-11H,14H2,1-2H3/b4-3-,7-5-.
What are the key properties of 3-[(3Z,5Z)-hepta-3,5-dien-2-yl]aniline?
3-[(3Z,5Z)-hepta-3,5-dien-2-yl]aniline has a molecular weight of 187.29 g/mol, XLogP of 3.50, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3Z,5Z)-hepta-3,5-dien-2-yl]aniline is sourced from PubChem (CID 88997026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).