C12H20N2 — CID 88997174
(4E,6Z,9Z)-11-imino-8-methylundeca-4,6,9-trien-4-amine (PubChem CID 88997174) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is (4E,6Z,9Z)-11-imino-8-methylundeca-4,6,9-trien-4-amine.
| Compound Name | (4E,6Z,9Z)-11-imino-8-methylundeca-4,6,9-trien-4-amine |
|---|---|
| PubChem CID | 88997174 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | (4E,6Z,9Z)-11-imino-8-methylundeca-4,6,9-trien-4-amine |
| SMILES | [H]/N=C/C=C\C(C)/C=C\C=C(\N)CCC |
| InChI | InChI=1S/C12H20N2/c1-3-6-12(14)9-4-7-11(2)8-5-10-13/h4-5,7-11,13H,3,6,14H2,1-2H3/b7-4-,8-5-,12-9+,13-10+ |
| InChIKey | WZCHJJZOALSBEE-KVFJAWDVSA-N |
| XLogP | 3.03 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|