methyl N-[(Z)-but-2-en-2-yl]ethanimidothioate

C7H13NS — CID 88997219

IUPACmethyl N-[(Z)-but-2-en-2-yl]ethanimidothioate
SMILESC/C=C(C)\N=C(/C)SC
InChIInChI=1S/C7H13NS/c1-5-6(2)8-7(3)9-4/h5H,1-4H3/b6-5-,8-7+
InChIKeyKIGSYFMHWUAEDZ-IGTJQSIKSA-N
MW143.25 g/mol
LogP2.69
Rot. Bonds1

About methyl N-[(Z)-but-2-en-2-yl]ethanimidothioate

methyl N-[(Z)-but-2-en-2-yl]ethanimidothioate (PubChem CID 88997219) has the molecular formula C7H13NS and a molecular weight of 143.25 g/mol. Its IUPAC name is methyl N-[(Z)-but-2-en-2-yl]ethanimidothioate.

Molecular Properties

Compound Namemethyl N-[(Z)-but-2-en-2-yl]ethanimidothioate
PubChem CID88997219
Molecular FormulaC7H13NS
Molecular Weight143.25 g/mol
Exact Mass143.08
IUPAC Namemethyl N-[(Z)-but-2-en-2-yl]ethanimidothioate
SMILESC/C=C(C)\N=C(/C)SC
InChIInChI=1S/C7H13NS/c1-5-6(2)8-7(3)9-4/h5H,1-4H3/b6-5-,8-7+
InChIKeyKIGSYFMHWUAEDZ-IGTJQSIKSA-N
XLogP2.69
TPSA12.36 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms9
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500143.25
LogP ≤ 52.69
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}

Analyze methyl N-[(Z)-but-2-en-2-yl]ethanimidothioate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl N-[(Z)-but-2-en-2-yl]ethanimidothioate?
The IUPAC name of methyl N-[(Z)-but-2-en-2-yl]ethanimidothioate (CID 88997219) is methyl N-[(Z)-but-2-en-2-yl]ethanimidothioate.
What is the SMILES notation for methyl N-[(Z)-but-2-en-2-yl]ethanimidothioate?
The canonical SMILES for methyl N-[(Z)-but-2-en-2-yl]ethanimidothioate is C/C=C(C)\N=C(/C)SC.
What is the InChIKey of methyl N-[(Z)-but-2-en-2-yl]ethanimidothioate?
The InChIKey is KIGSYFMHWUAEDZ-IGTJQSIKSA-N. The full InChI is InChI=1S/C7H13NS/c1-5-6(2)8-7(3)9-4/h5H,1-4H3/b6-5-,8-7+.
What are the key properties of methyl N-[(Z)-but-2-en-2-yl]ethanimidothioate?
methyl N-[(Z)-but-2-en-2-yl]ethanimidothioate has a molecular weight of 143.25 g/mol, XLogP of 2.69, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-[(Z)-but-2-en-2-yl]ethanimidothioate is sourced from PubChem (CID 88997219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).