About 2-cyclohexa-2,4-dien-1-yl-1-methylpyrrolidine
2-cyclohexa-2,4-dien-1-yl-1-methylpyrrolidine (PubChem CID 88997226) has the molecular formula C11H17N
and a molecular weight of 163.26 g/mol. Its IUPAC name is 2-cyclohexa-2,4-dien-1-yl-1-methylpyrrolidine.
Molecular Properties
| Compound Name | 2-cyclohexa-2,4-dien-1-yl-1-methylpyrrolidine |
| PubChem CID | 88997226 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | 2-cyclohexa-2,4-dien-1-yl-1-methylpyrrolidine |
| SMILES | CN1CCCC1C1C=CC=CC1 |
| InChI | InChI=1S/C11H17N/c1-12-9-5-8-11(12)10-6-3-2-4-7-10/h2-4,6,10-11H,5,7-9H2,1H3 |
| InChIKey | DOTPWAUZQQTBTP-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-cyclohexa-2,4-dien-1-yl-1-methylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexa-2,4-dien-1-yl-1-methylpyrrolidine?
The IUPAC name of 2-cyclohexa-2,4-dien-1-yl-1-methylpyrrolidine (CID 88997226) is 2-cyclohexa-2,4-dien-1-yl-1-methylpyrrolidine.
What is the SMILES notation for 2-cyclohexa-2,4-dien-1-yl-1-methylpyrrolidine?
The canonical SMILES for 2-cyclohexa-2,4-dien-1-yl-1-methylpyrrolidine is CN1CCCC1C1C=CC=CC1.
What is the InChIKey of 2-cyclohexa-2,4-dien-1-yl-1-methylpyrrolidine?
The InChIKey is DOTPWAUZQQTBTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N/c1-12-9-5-8-11(12)10-6-3-2-4-7-10/h2-4,6,10-11H,5,7-9H2,1H3.
What are the key properties of 2-cyclohexa-2,4-dien-1-yl-1-methylpyrrolidine?
2-cyclohexa-2,4-dien-1-yl-1-methylpyrrolidine has a molecular weight of 163.26 g/mol, XLogP of 2.21, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexa-2,4-dien-1-yl-1-methylpyrrolidine is sourced from PubChem (CID 88997226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).