About 2-(2,5,6-trifluorocyclohexa-1,5-dien-1-yl)propan-1-ol
2-(2,5,6-trifluorocyclohexa-1,5-dien-1-yl)propan-1-ol (PubChem CID 88997265) has the molecular formula C9H11F3O
and a molecular weight of 192.18 g/mol. Its IUPAC name is 2-(2,5,6-trifluorocyclohexa-1,5-dien-1-yl)propan-1-ol.
Analyze 2-(2,5,6-trifluorocyclohexa-1,5-dien-1-yl)propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,5,6-trifluorocyclohexa-1,5-dien-1-yl)propan-1-ol?
The IUPAC name of 2-(2,5,6-trifluorocyclohexa-1,5-dien-1-yl)propan-1-ol (CID 88997265) is 2-(2,5,6-trifluorocyclohexa-1,5-dien-1-yl)propan-1-ol.
What is the SMILES notation for 2-(2,5,6-trifluorocyclohexa-1,5-dien-1-yl)propan-1-ol?
The canonical SMILES for 2-(2,5,6-trifluorocyclohexa-1,5-dien-1-yl)propan-1-ol is CC(CO)C1=C(F)CCC(F)=C1F.
What is the InChIKey of 2-(2,5,6-trifluorocyclohexa-1,5-dien-1-yl)propan-1-ol?
The InChIKey is NZUGMPPESHTBFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11F3O/c1-5(4-13)8-6(10)2-3-7(11)9(8)12/h5,13H,2-4H2,1H3.
What are the key properties of 2-(2,5,6-trifluorocyclohexa-1,5-dien-1-yl)propan-1-ol?
2-(2,5,6-trifluorocyclohexa-1,5-dien-1-yl)propan-1-ol has a molecular weight of 192.18 g/mol, XLogP of 2.78, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,5,6-trifluorocyclohexa-1,5-dien-1-yl)propan-1-ol is sourced from PubChem (CID 88997265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).