About (5S)-5,7-dimethyl-1,6-dioxaspiro[2.5]octane
(5S)-5,7-dimethyl-1,6-dioxaspiro[2.5]octane (PubChem CID 88997491) has the molecular formula C8H14O2
and a molecular weight of 142.20 g/mol. Its IUPAC name is (5S)-5,7-dimethyl-1,6-dioxaspiro[2.5]octane.
Molecular Properties
| Compound Name | (5S)-5,7-dimethyl-1,6-dioxaspiro[2.5]octane |
| PubChem CID | 88997491 |
| Molecular Formula | C8H14O2 |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.10 |
| IUPAC Name | (5S)-5,7-dimethyl-1,6-dioxaspiro[2.5]octane |
| SMILES | CC1CC2(CO2)C[C@H](C)O1 |
| InChI | InChI=1S/C8H14O2/c1-6-3-8(5-9-8)4-7(2)10-6/h6-7H,3-5H2,1-2H3/t6-,7?,8?/m0/s1 |
| InChIKey | ZAYWRTXTXOAQCL-KKMMWDRVSA-N |
| XLogP | 1.34 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (5S)-5,7-dimethyl-1,6-dioxaspiro[2.5]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-5,7-dimethyl-1,6-dioxaspiro[2.5]octane?
The IUPAC name of (5S)-5,7-dimethyl-1,6-dioxaspiro[2.5]octane (CID 88997491) is (5S)-5,7-dimethyl-1,6-dioxaspiro[2.5]octane.
What is the SMILES notation for (5S)-5,7-dimethyl-1,6-dioxaspiro[2.5]octane?
The canonical SMILES for (5S)-5,7-dimethyl-1,6-dioxaspiro[2.5]octane is CC1CC2(CO2)C[C@H](C)O1.
What is the InChIKey of (5S)-5,7-dimethyl-1,6-dioxaspiro[2.5]octane?
The InChIKey is ZAYWRTXTXOAQCL-KKMMWDRVSA-N. The full InChI is InChI=1S/C8H14O2/c1-6-3-8(5-9-8)4-7(2)10-6/h6-7H,3-5H2,1-2H3/t6-,7?,8?/m0/s1.
What are the key properties of (5S)-5,7-dimethyl-1,6-dioxaspiro[2.5]octane?
(5S)-5,7-dimethyl-1,6-dioxaspiro[2.5]octane has a molecular weight of 142.20 g/mol, XLogP of 1.34, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-5,7-dimethyl-1,6-dioxaspiro[2.5]octane is sourced from PubChem (CID 88997491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).