C16H18F2O — CID 88997574
(3E,5Z,8E,11Z)-9-ethynyl-5,6-difluoro-4-methoxytrideca-1,3,5,8,11-pentaene (PubChem CID 88997574) has the molecular formula C16H18F2O and a molecular weight of 264.32 g/mol. Its IUPAC name is (3E,5Z,8E,11Z)-9-ethynyl-5,6-difluoro-4-methoxytrideca-1,3,5,8,11-pentaene.
| Compound Name | (3E,5Z,8E,11Z)-9-ethynyl-5,6-difluoro-4-methoxytrideca-1,3,5,8,11-pentaene |
|---|---|
| PubChem CID | 88997574 |
| Molecular Formula | C16H18F2O |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | (3E,5Z,8E,11Z)-9-ethynyl-5,6-difluoro-4-methoxytrideca-1,3,5,8,11-pentaene |
| SMILES | C#C/C(=C/C/C(F)=C(F)\C(=C/C=C)OC)C/C=C\C |
| InChI | InChI=1S/C16H18F2O/c1-5-8-10-13(7-3)11-12-14(17)16(18)15(19-4)9-6-2/h3,5-6,8-9,11H,2,10,12H2,1,4H3/b8-5-,13-11-,15-9+,16-14- |
| InChIKey | MYQJHSZISFVCNP-YQHKZJEFSA-N |
| XLogP | 4.77 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|