(4R)-2,3,4-trihydroxy-3,4-dihydro-2H-pyran-6-carboxylic acid

C6H8O6 — CID 88997793

IUPAC(4R)-2,3,4-trihydroxy-3,4-dihydro-2H-pyran-6-carboxylic acid
SMILESO=C(O)C1=C[C@@H](O)C(O)C(O)O1
InChIInChI=1S/C6H8O6/c7-2-1-3(5(9)10)12-6(11)4(2)8/h1-2,4,6-8,11H,(H,9,10)/t2-,4?,6?/m1/s1
InChIKeyIAKKJSVSFCTLRY-QYPLPCQSSA-N
MW176.12 g/mol
LogP-1.97
Rot. Bonds1

About (4R)-2,3,4-trihydroxy-3,4-dihydro-2H-pyran-6-carboxylic acid

(4R)-2,3,4-trihydroxy-3,4-dihydro-2H-pyran-6-carboxylic acid (PubChem CID 88997793) has the molecular formula C6H8O6 and a molecular weight of 176.12 g/mol. Its IUPAC name is (4R)-2,3,4-trihydroxy-3,4-dihydro-2H-pyran-6-carboxylic acid.

Molecular Properties

Compound Name(4R)-2,3,4-trihydroxy-3,4-dihydro-2H-pyran-6-carboxylic acid
PubChem CID88997793
Molecular FormulaC6H8O6
Molecular Weight176.12 g/mol
Exact Mass176.03
IUPAC Name(4R)-2,3,4-trihydroxy-3,4-dihydro-2H-pyran-6-carboxylic acid
SMILESO=C(O)C1=C[C@@H](O)C(O)C(O)O1
InChIInChI=1S/C6H8O6/c7-2-1-3(5(9)10)12-6(11)4(2)8/h1-2,4,6-8,11H,(H,9,10)/t2-,4?,6?/m1/s1
InChIKeyIAKKJSVSFCTLRY-QYPLPCQSSA-N
XLogP-1.97
TPSA107.22 Ų
H-Bond Donors4
H-Bond Acceptors5
Rotatable Bonds1
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500176.12
LogP ≤ 5-1.97
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 105

Analyze (4R)-2,3,4-trihydroxy-3,4-dihydro-2H-pyran-6-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (4R)-2,3,4-trihydroxy-3,4-dihydro-2H-pyran-6-carboxylic acid?
The IUPAC name of (4R)-2,3,4-trihydroxy-3,4-dihydro-2H-pyran-6-carboxylic acid (CID 88997793) is (4R)-2,3,4-trihydroxy-3,4-dihydro-2H-pyran-6-carboxylic acid.
What is the SMILES notation for (4R)-2,3,4-trihydroxy-3,4-dihydro-2H-pyran-6-carboxylic acid?
The canonical SMILES for (4R)-2,3,4-trihydroxy-3,4-dihydro-2H-pyran-6-carboxylic acid is O=C(O)C1=C[C@@H](O)C(O)C(O)O1.
What is the InChIKey of (4R)-2,3,4-trihydroxy-3,4-dihydro-2H-pyran-6-carboxylic acid?
The InChIKey is IAKKJSVSFCTLRY-QYPLPCQSSA-N. The full InChI is InChI=1S/C6H8O6/c7-2-1-3(5(9)10)12-6(11)4(2)8/h1-2,4,6-8,11H,(H,9,10)/t2-,4?,6?/m1/s1.
What are the key properties of (4R)-2,3,4-trihydroxy-3,4-dihydro-2H-pyran-6-carboxylic acid?
(4R)-2,3,4-trihydroxy-3,4-dihydro-2H-pyran-6-carboxylic acid has a molecular weight of 176.12 g/mol, XLogP of -1.97, 1 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-2,3,4-trihydroxy-3,4-dihydro-2H-pyran-6-carboxylic acid is sourced from PubChem (CID 88997793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).