C24H36FN — CID 88997990
(4R,6Z,8E)-6-ethyl-8-fluoro-4-methyl-N-[(4Z,6Z)-6-methyl-3-methylideneocta-4,6-dien-2-yl]undeca-1,6,8,10-tetraen-2-amine (PubChem CID 88997990) has the molecular formula C24H36FN and a molecular weight of 357.56 g/mol. Its IUPAC name is (4R,6Z,8E)-6-ethyl-8-fluoro-4-methyl-N-[(4Z,6Z)-6-methyl-3-methylideneocta-4,6-dien-2-yl]undeca-1,6,8,10-tetraen-2-amine.
| Compound Name | (4R,6Z,8E)-6-ethyl-8-fluoro-4-methyl-N-[(4Z,6Z)-6-methyl-3-methylideneocta-4,6-dien-2-yl]undeca-1,6,8,10-tetraen-2-amine |
|---|---|
| PubChem CID | 88997990 |
| Molecular Formula | C24H36FN |
| Molecular Weight | 357.56 g/mol |
| Exact Mass | 357.28 |
| IUPAC Name | (4R,6Z,8E)-6-ethyl-8-fluoro-4-methyl-N-[(4Z,6Z)-6-methyl-3-methylideneocta-4,6-dien-2-yl]undeca-1,6,8,10-tetraen-2-amine |
| SMILES | C=C/C=C(F)\C=C(\CC)C[C@@H](C)CC(=C)NC(C)C(=C)/C=C\C(C)=C/C |
| InChI | InChI=1S/C24H36FN/c1-9-12-24(25)17-23(11-3)16-19(5)15-21(7)26-22(8)20(6)14-13-18(4)10-2/h9-10,12-14,17,19,22,26H,1,6-7,11,15-16H2,2-5,8H3/b14-13-,18-10-,23-17-,24-12+/t19-,22?/m0/s1 |
| InChIKey | IWBGVAHUVQIIRD-UMQQUDSHSA-N |
| XLogP | 7.35 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.56 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|