About (2R)-5-ethyl-2,3-dihydropyridin-2-ol
(2R)-5-ethyl-2,3-dihydropyridin-2-ol (PubChem CID 88998011) has the molecular formula C7H11NO
and a molecular weight of 125.17 g/mol. Its IUPAC name is (2R)-5-ethyl-2,3-dihydropyridin-2-ol.
Molecular Properties
| Compound Name | (2R)-5-ethyl-2,3-dihydropyridin-2-ol |
| PubChem CID | 88998011 |
| Molecular Formula | C7H11NO |
| Molecular Weight | 125.17 g/mol |
| Exact Mass | 125.08 |
| IUPAC Name | (2R)-5-ethyl-2,3-dihydropyridin-2-ol |
| SMILES | CCC1=CC[C@@H](O)N=C1 |
| InChI | InChI=1S/C7H11NO/c1-2-6-3-4-7(9)8-5-6/h3,5,7,9H,2,4H2,1H3/t7-/m1/s1 |
| InChIKey | ALVOPIBZFYCOCU-SSDOTTSWSA-N |
| XLogP | 1.12 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.17 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R)-5-ethyl-2,3-dihydropyridin-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-5-ethyl-2,3-dihydropyridin-2-ol?
The IUPAC name of (2R)-5-ethyl-2,3-dihydropyridin-2-ol (CID 88998011) is (2R)-5-ethyl-2,3-dihydropyridin-2-ol.
What is the SMILES notation for (2R)-5-ethyl-2,3-dihydropyridin-2-ol?
The canonical SMILES for (2R)-5-ethyl-2,3-dihydropyridin-2-ol is CCC1=CC[C@@H](O)N=C1.
What is the InChIKey of (2R)-5-ethyl-2,3-dihydropyridin-2-ol?
The InChIKey is ALVOPIBZFYCOCU-SSDOTTSWSA-N. The full InChI is InChI=1S/C7H11NO/c1-2-6-3-4-7(9)8-5-6/h3,5,7,9H,2,4H2,1H3/t7-/m1/s1.
What are the key properties of (2R)-5-ethyl-2,3-dihydropyridin-2-ol?
(2R)-5-ethyl-2,3-dihydropyridin-2-ol has a molecular weight of 125.17 g/mol, XLogP of 1.12, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-5-ethyl-2,3-dihydropyridin-2-ol is sourced from PubChem (CID 88998011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).