C11H18N2 — CID 88998046
(3Z,5Z)-2-N-ethenyl-6-methylocta-3,5,7-triene-2,3-diamine (PubChem CID 88998046) has the molecular formula C11H18N2 and a molecular weight of 178.28 g/mol. Its IUPAC name is (3Z,5Z)-2-N-ethenyl-6-methylocta-3,5,7-triene-2,3-diamine.
| Compound Name | (3Z,5Z)-2-N-ethenyl-6-methylocta-3,5,7-triene-2,3-diamine |
|---|---|
| PubChem CID | 88998046 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | (3Z,5Z)-2-N-ethenyl-6-methylocta-3,5,7-triene-2,3-diamine |
| SMILES | C=CNC(C)/C(N)=C/C=C(/C)C=C |
| InChI | InChI=1S/C11H18N2/c1-5-9(3)7-8-11(12)10(4)13-6-2/h5-8,10,13H,1-2,12H2,3-4H3/b9-7-,11-8- |
| InChIKey | BKHNBRKIELMSOF-JLUCNAMBSA-N |
| XLogP | 2.08 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|