C23H33N3 — CID 88998058
(2R)-3-[(Z)-2-aminoprop-1-enyl]imino-N-[1-[2-[(2E,4Z,7Z)-6-methylidenenona-2,4,7-trien-2-yl]cyclopropyl]ethenyl]pent-4-en-2-amine (PubChem CID 88998058) has the molecular formula C23H33N3 and a molecular weight of 351.54 g/mol. Its IUPAC name is (2R)-3-[(Z)-2-aminoprop-1-enyl]imino-N-[1-[2-[(2E,4Z,7Z)-6-methylidenenona-2,4,7-trien-2-yl]cyclopropyl]ethenyl]pent-4-en-2-amine.
| Compound Name | (2R)-3-[(Z)-2-aminoprop-1-enyl]imino-N-[1-[2-[(2E,4Z,7Z)-6-methylidenenona-2,4,7-trien-2-yl]cyclopropyl]ethenyl]pent-4-en-2-amine |
|---|---|
| PubChem CID | 88998058 |
| Molecular Formula | C23H33N3 |
| Molecular Weight | 351.54 g/mol |
| Exact Mass | 351.27 |
| IUPAC Name | (2R)-3-[(Z)-2-aminoprop-1-enyl]imino-N-[1-[2-[(2E,4Z,7Z)-6-methylidenenona-2,4,7-trien-2-yl]cyclopropyl]ethenyl]pent-4-en-2-amine |
| SMILES | C=C/C(=N\C=C(\C)N)[C@@H](C)NC(=C)C1CC1/C(C)=C/C=C\C(=C)/C=C\C |
| InChI | InChI=1S/C23H33N3/c1-8-11-16(3)12-10-13-17(4)21-14-22(21)19(6)26-20(7)23(9-2)25-15-18(5)24/h8-13,15,20-22,26H,2-3,6,14,24H2,1,4-5,7H3/b11-8-,12-10-,17-13+,18-15-,25-23+/t20-,21?,22?/m1/s1 |
| InChIKey | RRGKQRNJQZDZOI-YTQHOWPPSA-N |
| XLogP | 5.20 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.54 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|