C18H23F3N2 — CID 88998201
(3Z,5Z)-6-methyl-2-N-[(4Z)-3-methylidene-6-(trifluoromethyl)hepta-1,4,6-trien-2-yl]octa-3,5,7-triene-2,3-diamine (PubChem CID 88998201) has the molecular formula C18H23F3N2 and a molecular weight of 324.39 g/mol. Its IUPAC name is (3Z,5Z)-6-methyl-2-N-[(4Z)-3-methylidene-6-(trifluoromethyl)hepta-1,4,6-trien-2-yl]octa-3,5,7-triene-2,3-diamine.
| Compound Name | (3Z,5Z)-6-methyl-2-N-[(4Z)-3-methylidene-6-(trifluoromethyl)hepta-1,4,6-trien-2-yl]octa-3,5,7-triene-2,3-diamine |
|---|---|
| PubChem CID | 88998201 |
| Molecular Formula | C18H23F3N2 |
| Molecular Weight | 324.39 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | (3Z,5Z)-6-methyl-2-N-[(4Z)-3-methylidene-6-(trifluoromethyl)hepta-1,4,6-trien-2-yl]octa-3,5,7-triene-2,3-diamine |
| SMILES | C=C/C(C)=C\C=C(/N)C(C)NC(=C)C(=C)/C=C\C(=C)C(F)(F)F |
| InChI | InChI=1S/C18H23F3N2/c1-7-12(2)8-11-17(22)16(6)23-15(5)13(3)9-10-14(4)18(19,20)21/h7-11,16,23H,1,3-5,22H2,2,6H3/b10-9-,12-8-,17-11- |
| InChIKey | TYTOALCRIFNFNI-SOMNQZIASA-N |
| XLogP | 4.68 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.39 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|