C12H21FN2O — CID 88998208
(3Z,5E)-6-(2-fluoro-2-methylpropoxy)octa-3,5,7-triene-2,3-diamine (PubChem CID 88998208) has the molecular formula C12H21FN2O and a molecular weight of 228.31 g/mol. Its IUPAC name is (3Z,5E)-6-(2-fluoro-2-methylpropoxy)octa-3,5,7-triene-2,3-diamine.
| Compound Name | (3Z,5E)-6-(2-fluoro-2-methylpropoxy)octa-3,5,7-triene-2,3-diamine |
|---|---|
| PubChem CID | 88998208 |
| Molecular Formula | C12H21FN2O |
| Molecular Weight | 228.31 g/mol |
| Exact Mass | 228.16 |
| IUPAC Name | (3Z,5E)-6-(2-fluoro-2-methylpropoxy)octa-3,5,7-triene-2,3-diamine |
| SMILES | C=C/C(=C\C=C(/N)C(C)N)OCC(C)(C)F |
| InChI | InChI=1S/C12H21FN2O/c1-5-10(16-8-12(3,4)13)6-7-11(15)9(2)14/h5-7,9H,1,8,14-15H2,2-4H3/b10-6+,11-7- |
| InChIKey | JNIZZUMNSPTWLO-QZTBCQRESA-N |
| XLogP | 2.01 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.31 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|