About (2S)-1,2-diiodocyclobutane
(2S)-1,2-diiodocyclobutane (PubChem CID 88998868) has the molecular formula C4H6I2
and a molecular weight of 307.90 g/mol. Its IUPAC name is (2S)-1,2-diiodocyclobutane.
Molecular Properties
| Compound Name | (2S)-1,2-diiodocyclobutane |
| PubChem CID | 88998868 |
| Molecular Formula | C4H6I2 |
| Molecular Weight | 307.90 g/mol |
| Exact Mass | 307.86 |
| IUPAC Name | (2S)-1,2-diiodocyclobutane |
| SMILES | IC1CC[C@@H]1I |
| InChI | InChI=1S/C4H6I2/c5-3-1-2-4(3)6/h3-4H,1-2H2/t3-,4?/m0/s1 |
| InChIKey | YCRHYFBSNZTSAJ-WUCPZUCCSA-N |
| XLogP | 2.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.90 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (2S)-1,2-diiodocyclobutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-1,2-diiodocyclobutane?
The IUPAC name of (2S)-1,2-diiodocyclobutane (CID 88998868) is (2S)-1,2-diiodocyclobutane.
What is the SMILES notation for (2S)-1,2-diiodocyclobutane?
The canonical SMILES for (2S)-1,2-diiodocyclobutane is IC1CC[C@@H]1I.
What is the InChIKey of (2S)-1,2-diiodocyclobutane?
The InChIKey is YCRHYFBSNZTSAJ-WUCPZUCCSA-N. The full InChI is InChI=1S/C4H6I2/c5-3-1-2-4(3)6/h3-4H,1-2H2/t3-,4?/m0/s1.
What are the key properties of (2S)-1,2-diiodocyclobutane?
(2S)-1,2-diiodocyclobutane has a molecular weight of 307.90 g/mol, XLogP of 2.39, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1,2-diiodocyclobutane is sourced from PubChem (CID 88998868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).