About 1-methyl-3,5-bis(trifluoromethyl)cyclohexa-1,3-diene
1-methyl-3,5-bis(trifluoromethyl)cyclohexa-1,3-diene (PubChem CID 88998982) has the molecular formula C9H8F6
and a molecular weight of 230.15 g/mol. Its IUPAC name is 1-methyl-3,5-bis(trifluoromethyl)cyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 1-methyl-3,5-bis(trifluoromethyl)cyclohexa-1,3-diene |
| PubChem CID | 88998982 |
| Molecular Formula | C9H8F6 |
| Molecular Weight | 230.15 g/mol |
| Exact Mass | 230.05 |
| IUPAC Name | 1-methyl-3,5-bis(trifluoromethyl)cyclohexa-1,3-diene |
| SMILES | CC1=CC(C(F)(F)F)=CC(C(F)(F)F)C1 |
| InChI | InChI=1S/C9H8F6/c1-5-2-6(8(10,11)12)4-7(3-5)9(13,14)15/h2,4,7H,3H2,1H3 |
| InChIKey | UDMJYIWGMWNJSN-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.15 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-methyl-3,5-bis(trifluoromethyl)cyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-3,5-bis(trifluoromethyl)cyclohexa-1,3-diene?
The IUPAC name of 1-methyl-3,5-bis(trifluoromethyl)cyclohexa-1,3-diene (CID 88998982) is 1-methyl-3,5-bis(trifluoromethyl)cyclohexa-1,3-diene.
What is the SMILES notation for 1-methyl-3,5-bis(trifluoromethyl)cyclohexa-1,3-diene?
The canonical SMILES for 1-methyl-3,5-bis(trifluoromethyl)cyclohexa-1,3-diene is CC1=CC(C(F)(F)F)=CC(C(F)(F)F)C1.
What is the InChIKey of 1-methyl-3,5-bis(trifluoromethyl)cyclohexa-1,3-diene?
The InChIKey is UDMJYIWGMWNJSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8F6/c1-5-2-6(8(10,11)12)4-7(3-5)9(13,14)15/h2,4,7H,3H2,1H3.
What are the key properties of 1-methyl-3,5-bis(trifluoromethyl)cyclohexa-1,3-diene?
1-methyl-3,5-bis(trifluoromethyl)cyclohexa-1,3-diene has a molecular weight of 230.15 g/mol, XLogP of 4.00, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3,5-bis(trifluoromethyl)cyclohexa-1,3-diene is sourced from PubChem (CID 88998982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).