C19H28N4O5S — CID 88999211
(2S)-2-[[(2R)-2-amino-3-methyl-3-sulfanylbutanoyl]amino]-3-[4-(piperazine-1-carbonyloxy)phenyl]propanoic acid (PubChem CID 88999211) has the molecular formula C19H28N4O5S and a molecular weight of 424.52 g/mol. Its IUPAC name is (2S)-2-[[(2R)-2-amino-3-methyl-3-sulfanylbutanoyl]amino]-3-[4-(piperazine-1-carbonyloxy)phenyl]propanoic acid.
| Compound Name | (2S)-2-[[(2R)-2-amino-3-methyl-3-sulfanylbutanoyl]amino]-3-[4-(piperazine-1-carbonyloxy)phenyl]propanoic acid |
|---|---|
| PubChem CID | 88999211 |
| Molecular Formula | C19H28N4O5S |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | (2S)-2-[[(2R)-2-amino-3-methyl-3-sulfanylbutanoyl]amino]-3-[4-(piperazine-1-carbonyloxy)phenyl]propanoic acid |
| SMILES | CC(C)(S)[C@H](N)C(=O)N[C@@H](Cc1ccc(OC(=O)N2CCNCC2)cc1)C(=O)O |
| InChI | InChI=1S/C19H28N4O5S/c1-19(2,29)15(20)16(24)22-14(17(25)26)11-12-3-5-13(6-4-12)28-18(27)23-9-7-21-8-10-23/h3-6,14-15,21,29H,7-11,20H2,1-2H3,(H,22,24)(H,25,26)/t14-,15+/m0/s1 |
| InChIKey | WCMFXLCTJSYWQR-LSDHHAIUSA-N |
| XLogP | 0.24 |
| TPSA | 133.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|