About 2-hydroxy-5-[(E)-2-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)ethenyl]benzoic acid
2-hydroxy-5-[(E)-2-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)ethenyl]benzoic acid (PubChem CID 88999310) has the molecular formula C24H22NO3+
and a molecular weight of 372.44 g/mol. Its IUPAC name is 2-hydroxy-5-[(E)-2-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)ethenyl]benzoic acid.
Molecular Properties
| Compound Name | 2-hydroxy-5-[(E)-2-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)ethenyl]benzoic acid |
| PubChem CID | 88999310 |
| Molecular Formula | C24H22NO3+ |
| Molecular Weight | 372.44 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | 2-hydroxy-5-[(E)-2-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)ethenyl]benzoic acid |
| SMILES | C[N+]1=C(/C=C/c2ccc(O)c(C(=O)O)c2)C(C)(C)c2c1ccc1ccccc21 |
| InChI | InChI=1S/C24H21NO3/c1-24(2)21(13-9-15-8-12-20(26)18(14-15)23(27)28)25(3)19-11-10-16-6-4-5-7-17(16)22(19)24/h4-14H,1-3H3,(H,27,28)/p+1 |
| InChIKey | HCKQXWPJZSIEJK-UHFFFAOYSA-O |
| XLogP | 4.96 |
| TPSA | 60.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.44 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxy-5-[(E)-2-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)ethenyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-5-[(E)-2-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)ethenyl]benzoic acid?
The IUPAC name of 2-hydroxy-5-[(E)-2-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)ethenyl]benzoic acid (CID 88999310) is 2-hydroxy-5-[(E)-2-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)ethenyl]benzoic acid.
What is the SMILES notation for 2-hydroxy-5-[(E)-2-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)ethenyl]benzoic acid?
The canonical SMILES for 2-hydroxy-5-[(E)-2-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)ethenyl]benzoic acid is C[N+]1=C(/C=C/c2ccc(O)c(C(=O)O)c2)C(C)(C)c2c1ccc1ccccc21.
What is the InChIKey of 2-hydroxy-5-[(E)-2-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)ethenyl]benzoic acid?
The InChIKey is HCKQXWPJZSIEJK-UHFFFAOYSA-O. The full InChI is InChI=1S/C24H21NO3/c1-24(2)21(13-9-15-8-12-20(26)18(14-15)23(27)28)25(3)19-11-10-16-6-4-5-7-17(16)22(19)24/h4-14H,1-3H3,(H,27,28)/p+1.
What are the key properties of 2-hydroxy-5-[(E)-2-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)ethenyl]benzoic acid?
2-hydroxy-5-[(E)-2-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)ethenyl]benzoic acid has a molecular weight of 372.44 g/mol, XLogP of 4.96, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-5-[(E)-2-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)ethenyl]benzoic acid is sourced from PubChem (CID 88999310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).