About [3-(2-methyl-1,3-dioxolan-2-yl)phenyl]phosphane
[3-(2-methyl-1,3-dioxolan-2-yl)phenyl]phosphane (PubChem CID 88999598) has the molecular formula C10H13O2P
and a molecular weight of 196.19 g/mol. Its IUPAC name is [3-(2-methyl-1,3-dioxolan-2-yl)phenyl]phosphane.
Molecular Properties
| Compound Name | [3-(2-methyl-1,3-dioxolan-2-yl)phenyl]phosphane |
| PubChem CID | 88999598 |
| Molecular Formula | C10H13O2P |
| Molecular Weight | 196.19 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | [3-(2-methyl-1,3-dioxolan-2-yl)phenyl]phosphane |
| SMILES | CC1(c2cccc(P)c2)OCCO1 |
| InChI | InChI=1S/C10H13O2P/c1-10(11-5-6-12-10)8-3-2-4-9(13)7-8/h2-4,7H,5-6,13H2,1H3 |
| InChIKey | AFVLDVGNIZRPSJ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.19 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [3-(2-methyl-1,3-dioxolan-2-yl)phenyl]phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(2-methyl-1,3-dioxolan-2-yl)phenyl]phosphane?
The IUPAC name of [3-(2-methyl-1,3-dioxolan-2-yl)phenyl]phosphane (CID 88999598) is [3-(2-methyl-1,3-dioxolan-2-yl)phenyl]phosphane.
What is the SMILES notation for [3-(2-methyl-1,3-dioxolan-2-yl)phenyl]phosphane?
The canonical SMILES for [3-(2-methyl-1,3-dioxolan-2-yl)phenyl]phosphane is CC1(c2cccc(P)c2)OCCO1.
What is the InChIKey of [3-(2-methyl-1,3-dioxolan-2-yl)phenyl]phosphane?
The InChIKey is AFVLDVGNIZRPSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13O2P/c1-10(11-5-6-12-10)8-3-2-4-9(13)7-8/h2-4,7H,5-6,13H2,1H3.
What are the key properties of [3-(2-methyl-1,3-dioxolan-2-yl)phenyl]phosphane?
[3-(2-methyl-1,3-dioxolan-2-yl)phenyl]phosphane has a molecular weight of 196.19 g/mol, XLogP of 1.41, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(2-methyl-1,3-dioxolan-2-yl)phenyl]phosphane is sourced from PubChem (CID 88999598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).