C21H21N5O2 — CID 89000081
2-[2-(3-aminophenyl)ethyl]-1'-methylspiro[5,7-dihydro-3H-cyclopenta[f]benzimidazole-6,5'-imidazolidine]-2',4'-dione (PubChem CID 89000081) has the molecular formula C21H21N5O2 and a molecular weight of 375.43 g/mol. Its IUPAC name is 2-[2-(3-aminophenyl)ethyl]-1'-methylspiro[5,7-dihydro-3H-cyclopenta[f]benzimidazole-6,5'-imidazolidine]-2',4'-dione.
| Compound Name | 2-[2-(3-aminophenyl)ethyl]-1'-methylspiro[5,7-dihydro-3H-cyclopenta[f]benzimidazole-6,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 89000081 |
| Molecular Formula | C21H21N5O2 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | 2-[2-(3-aminophenyl)ethyl]-1'-methylspiro[5,7-dihydro-3H-cyclopenta[f]benzimidazole-6,5'-imidazolidine]-2',4'-dione |
| SMILES | CN1C(=O)NC(=O)C12Cc1cc3nc(CCc4cccc(N)c4)[nH]c3cc1C2 |
| InChI | InChI=1S/C21H21N5O2/c1-26-20(28)25-19(27)21(26)10-13-8-16-17(9-14(13)11-21)24-18(23-16)6-5-12-3-2-4-15(22)7-12/h2-4,7-9H,5-6,10-11,22H2,1H3,(H,23,24)(H,25,27,28) |
| InChIKey | TYWKAARYXJKPNY-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 104.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|