C18H26N6OS — CID 89000093
N'-(4-tert-butylphenyl)-N-hydroxy-4-(4-methyl-1,2,5-thiadiazol-3-yl)piperazine-1-carboximidamide (PubChem CID 89000093) has the molecular formula C18H26N6OS and a molecular weight of 374.51 g/mol. Its IUPAC name is N'-(4-tert-butylphenyl)-N-hydroxy-4-(4-methyl-1,2,5-thiadiazol-3-yl)piperazine-1-carboximidamide.
| Compound Name | N'-(4-tert-butylphenyl)-N-hydroxy-4-(4-methyl-1,2,5-thiadiazol-3-yl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 89000093 |
| Molecular Formula | C18H26N6OS |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | N'-(4-tert-butylphenyl)-N-hydroxy-4-(4-methyl-1,2,5-thiadiazol-3-yl)piperazine-1-carboximidamide |
| SMILES | Cc1nsnc1N1CCN(/C(=N/c2ccc(C(C)(C)C)cc2)NO)CC1 |
| InChI | InChI=1S/C18H26N6OS/c1-13-16(22-26-21-13)23-9-11-24(12-10-23)17(20-25)19-15-7-5-14(6-8-15)18(2,3)4/h5-8,25H,9-12H2,1-4H3,(H,19,20) |
| InChIKey | WLNVVFBBZIFACC-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|