C14H14F4N6OS — CID 89000096
4-(4-fluoro-1,2,5-thiadiazol-3-yl)-N-hydroxy-N'-[4-(trifluoromethyl)phenyl]piperazine-1-carboximidamide (PubChem CID 89000096) has the molecular formula C14H14F4N6OS and a molecular weight of 390.37 g/mol. Its IUPAC name is 4-(4-fluoro-1,2,5-thiadiazol-3-yl)-N-hydroxy-N'-[4-(trifluoromethyl)phenyl]piperazine-1-carboximidamide.
| Compound Name | 4-(4-fluoro-1,2,5-thiadiazol-3-yl)-N-hydroxy-N'-[4-(trifluoromethyl)phenyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 89000096 |
| Molecular Formula | C14H14F4N6OS |
| Molecular Weight | 390.37 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | 4-(4-fluoro-1,2,5-thiadiazol-3-yl)-N-hydroxy-N'-[4-(trifluoromethyl)phenyl]piperazine-1-carboximidamide |
| SMILES | ON/C(=N\c1ccc(C(F)(F)F)cc1)N1CCN(c2nsnc2F)CC1 |
| InChI | InChI=1S/C14H14F4N6OS/c15-11-12(22-26-21-11)23-5-7-24(8-6-23)13(20-25)19-10-3-1-9(2-4-10)14(16,17)18/h1-4,25H,5-8H2,(H,19,20) |
| InChIKey | WPNWXZZSIVFCGU-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.37 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|