C15H16ClF3N6OS — CID 89000100
4-(4-chloro-1,2,5-thiadiazol-3-yl)-N-methoxy-N'-[4-(trifluoromethyl)phenyl]piperazine-1-carboximidamide (PubChem CID 89000100) has the molecular formula C15H16ClF3N6OS and a molecular weight of 420.85 g/mol. Its IUPAC name is 4-(4-chloro-1,2,5-thiadiazol-3-yl)-N-methoxy-N'-[4-(trifluoromethyl)phenyl]piperazine-1-carboximidamide.
| Compound Name | 4-(4-chloro-1,2,5-thiadiazol-3-yl)-N-methoxy-N'-[4-(trifluoromethyl)phenyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 89000100 |
| Molecular Formula | C15H16ClF3N6OS |
| Molecular Weight | 420.85 g/mol |
| Exact Mass | 420.07 |
| IUPAC Name | 4-(4-chloro-1,2,5-thiadiazol-3-yl)-N-methoxy-N'-[4-(trifluoromethyl)phenyl]piperazine-1-carboximidamide |
| SMILES | CON/C(=N\c1ccc(C(F)(F)F)cc1)N1CCN(c2nsnc2Cl)CC1 |
| InChI | InChI=1S/C15H16ClF3N6OS/c1-26-21-14(20-11-4-2-10(3-5-11)15(17,18)19)25-8-6-24(7-9-25)13-12(16)22-27-23-13/h2-5H,6-9H2,1H3,(H,20,21) |
| InChIKey | MMLLRVKENKJRRV-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.85 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|