C8H15FN2 — CID 89000282
(2E,4E)-7-fluoro-6-methylhepta-2,4-diene-3,4-diamine (PubChem CID 89000282) has the molecular formula C8H15FN2 and a molecular weight of 158.22 g/mol. Its IUPAC name is (2E,4E)-7-fluoro-6-methylhepta-2,4-diene-3,4-diamine.
| Compound Name | (2E,4E)-7-fluoro-6-methylhepta-2,4-diene-3,4-diamine |
|---|---|
| PubChem CID | 89000282 |
| Molecular Formula | C8H15FN2 |
| Molecular Weight | 158.22 g/mol |
| Exact Mass | 158.12 |
| IUPAC Name | (2E,4E)-7-fluoro-6-methylhepta-2,4-diene-3,4-diamine |
| SMILES | C/C=C(N)\C(N)=C/C(C)CF |
| InChI | InChI=1S/C8H15FN2/c1-3-7(10)8(11)4-6(2)5-9/h3-4,6H,5,10-11H2,1-2H3/b7-3+,8-4+ |
| InChIKey | NMNCSLNFBPMXDE-FCXRPNKRSA-N |
| XLogP | 1.30 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.22 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|