About N-(6-methylcyclohexa-2,4-dien-1-yl)methanimine
N-(6-methylcyclohexa-2,4-dien-1-yl)methanimine (PubChem CID 89000302) has the molecular formula C8H11N
and a molecular weight of 121.18 g/mol. Its IUPAC name is N-(6-methylcyclohexa-2,4-dien-1-yl)methanimine.
Molecular Properties
| Compound Name | N-(6-methylcyclohexa-2,4-dien-1-yl)methanimine |
| PubChem CID | 89000302 |
| Molecular Formula | C8H11N |
| Molecular Weight | 121.18 g/mol |
| Exact Mass | 121.09 |
| IUPAC Name | N-(6-methylcyclohexa-2,4-dien-1-yl)methanimine |
| SMILES | C=NC1C=CC=CC1C |
| InChI | InChI=1S/C8H11N/c1-7-5-3-4-6-8(7)9-2/h3-8H,2H2,1H3 |
| InChIKey | NTVIBTNZALOLSN-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 121.18 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-(6-methylcyclohexa-2,4-dien-1-yl)methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6-methylcyclohexa-2,4-dien-1-yl)methanimine?
The IUPAC name of N-(6-methylcyclohexa-2,4-dien-1-yl)methanimine (CID 89000302) is N-(6-methylcyclohexa-2,4-dien-1-yl)methanimine.
What is the SMILES notation for N-(6-methylcyclohexa-2,4-dien-1-yl)methanimine?
The canonical SMILES for N-(6-methylcyclohexa-2,4-dien-1-yl)methanimine is C=NC1C=CC=CC1C.
What is the InChIKey of N-(6-methylcyclohexa-2,4-dien-1-yl)methanimine?
The InChIKey is NTVIBTNZALOLSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N/c1-7-5-3-4-6-8(7)9-2/h3-8H,2H2,1H3.
What are the key properties of N-(6-methylcyclohexa-2,4-dien-1-yl)methanimine?
N-(6-methylcyclohexa-2,4-dien-1-yl)methanimine has a molecular weight of 121.18 g/mol, XLogP of 1.82, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6-methylcyclohexa-2,4-dien-1-yl)methanimine is sourced from PubChem (CID 89000302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).