C11H14F2O9S2 — CID 89000357
1,1-difluoro-2-oxo-2-[(1,2,3-trimethyl-5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-9-yl)oxy]ethanesulfonic acid (PubChem CID 89000357) has the molecular formula C11H14F2O9S2 and a molecular weight of 392.35 g/mol. Its IUPAC name is 1,1-difluoro-2-oxo-2-[(1,2,3-trimethyl-5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-9-yl)oxy]ethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-oxo-2-[(1,2,3-trimethyl-5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-9-yl)oxy]ethanesulfonic acid |
|---|---|
| PubChem CID | 89000357 |
| Molecular Formula | C11H14F2O9S2 |
| Molecular Weight | 392.35 g/mol |
| Exact Mass | 392.00 |
| IUPAC Name | 1,1-difluoro-2-oxo-2-[(1,2,3-trimethyl-5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-9-yl)oxy]ethanesulfonic acid |
| SMILES | CC1C2(C)OC3C(C2OC(=O)C(F)(F)S(=O)(=O)O)S(=O)(=O)OC31C |
| InChI | InChI=1S/C11H14F2O9S2/c1-4-9(2)6(20-8(14)11(12,13)24(17,18)19)5-7(21-9)10(4,3)22-23(5,15)16/h4-7H,1-3H3,(H,17,18,19) |
| InChIKey | YGHAAFRZQFMLAZ-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 133.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.35 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|