C14H22N2 — CID 89000384
2-(4-methylphenyl)-1-N-propan-2-ylbut-3-ene-1,3-diamine (PubChem CID 89000384) has the molecular formula C14H22N2 and a molecular weight of 218.34 g/mol. Its IUPAC name is 2-(4-methylphenyl)-1-N-propan-2-ylbut-3-ene-1,3-diamine.
| Compound Name | 2-(4-methylphenyl)-1-N-propan-2-ylbut-3-ene-1,3-diamine |
|---|---|
| PubChem CID | 89000384 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | 2-(4-methylphenyl)-1-N-propan-2-ylbut-3-ene-1,3-diamine |
| SMILES | C=C(N)C(CNC(C)C)c1ccc(C)cc1 |
| InChI | InChI=1S/C14H22N2/c1-10(2)16-9-14(12(4)15)13-7-5-11(3)6-8-13/h5-8,10,14,16H,4,9,15H2,1-3H3 |
| InChIKey | QLNZYHNJNWDFPV-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |