About [8,8-bis(trifluoromethyl)-7-oxabicyclo[4.2.0]octan-4-yl] 2-methylprop-2-enoate
[8,8-bis(trifluoromethyl)-7-oxabicyclo[4.2.0]octan-4-yl] 2-methylprop-2-enoate (PubChem CID 89000471) has the molecular formula C13H14F6O3
and a molecular weight of 332.24 g/mol. Its IUPAC name is [8,8-bis(trifluoromethyl)-7-oxabicyclo[4.2.0]octan-4-yl] 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | [8,8-bis(trifluoromethyl)-7-oxabicyclo[4.2.0]octan-4-yl] 2-methylprop-2-enoate |
| PubChem CID | 89000471 |
| Molecular Formula | C13H14F6O3 |
| Molecular Weight | 332.24 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | [8,8-bis(trifluoromethyl)-7-oxabicyclo[4.2.0]octan-4-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1CCC2C(C1)OC2(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C13H14F6O3/c1-6(2)10(20)21-7-3-4-8-9(5-7)22-11(8,12(14,15)16)13(17,18)19/h7-9H,1,3-5H2,2H3 |
| InChIKey | UZRCSOGSEOXURS-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.24 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [8,8-bis(trifluoromethyl)-7-oxabicyclo[4.2.0]octan-4-yl] 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [8,8-bis(trifluoromethyl)-7-oxabicyclo[4.2.0]octan-4-yl] 2-methylprop-2-enoate?
The IUPAC name of [8,8-bis(trifluoromethyl)-7-oxabicyclo[4.2.0]octan-4-yl] 2-methylprop-2-enoate (CID 89000471) is [8,8-bis(trifluoromethyl)-7-oxabicyclo[4.2.0]octan-4-yl] 2-methylprop-2-enoate.
What is the SMILES notation for [8,8-bis(trifluoromethyl)-7-oxabicyclo[4.2.0]octan-4-yl] 2-methylprop-2-enoate?
The canonical SMILES for [8,8-bis(trifluoromethyl)-7-oxabicyclo[4.2.0]octan-4-yl] 2-methylprop-2-enoate is C=C(C)C(=O)OC1CCC2C(C1)OC2(C(F)(F)F)C(F)(F)F.
What is the InChIKey of [8,8-bis(trifluoromethyl)-7-oxabicyclo[4.2.0]octan-4-yl] 2-methylprop-2-enoate?
The InChIKey is UZRCSOGSEOXURS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14F6O3/c1-6(2)10(20)21-7-3-4-8-9(5-7)22-11(8,12(14,15)16)13(17,18)19/h7-9H,1,3-5H2,2H3.
What are the key properties of [8,8-bis(trifluoromethyl)-7-oxabicyclo[4.2.0]octan-4-yl] 2-methylprop-2-enoate?
[8,8-bis(trifluoromethyl)-7-oxabicyclo[4.2.0]octan-4-yl] 2-methylprop-2-enoate has a molecular weight of 332.24 g/mol, XLogP of 3.54, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [8,8-bis(trifluoromethyl)-7-oxabicyclo[4.2.0]octan-4-yl] 2-methylprop-2-enoate is sourced from PubChem (CID 89000471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).