About 2-tert-butyl-5,6-dihydro-1H-pyrrolo[2,3-b]pyridine
2-tert-butyl-5,6-dihydro-1H-pyrrolo[2,3-b]pyridine (PubChem CID 89000850) has the molecular formula C11H16N2
and a molecular weight of 176.26 g/mol. Its IUPAC name is 2-tert-butyl-5,6-dihydro-1H-pyrrolo[2,3-b]pyridine.
Molecular Properties
| Compound Name | 2-tert-butyl-5,6-dihydro-1H-pyrrolo[2,3-b]pyridine |
| PubChem CID | 89000850 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | 2-tert-butyl-5,6-dihydro-1H-pyrrolo[2,3-b]pyridine |
| SMILES | CC(C)(C)c1cc2c([nH]1)=NCCC=2 |
| InChI | InChI=1S/C11H16N2/c1-11(2,3)9-7-8-5-4-6-12-10(8)13-9/h5,7H,4,6H2,1-3H3,(H,12,13) |
| InChIKey | DSBCRDLUXIXXKT-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 28.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-tert-butyl-5,6-dihydro-1H-pyrrolo[2,3-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-5,6-dihydro-1H-pyrrolo[2,3-b]pyridine?
The IUPAC name of 2-tert-butyl-5,6-dihydro-1H-pyrrolo[2,3-b]pyridine (CID 89000850) is 2-tert-butyl-5,6-dihydro-1H-pyrrolo[2,3-b]pyridine.
What is the SMILES notation for 2-tert-butyl-5,6-dihydro-1H-pyrrolo[2,3-b]pyridine?
The canonical SMILES for 2-tert-butyl-5,6-dihydro-1H-pyrrolo[2,3-b]pyridine is CC(C)(C)c1cc2c([nH]1)=NCCC=2.
What is the InChIKey of 2-tert-butyl-5,6-dihydro-1H-pyrrolo[2,3-b]pyridine?
The InChIKey is DSBCRDLUXIXXKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2/c1-11(2,3)9-7-8-5-4-6-12-10(8)13-9/h5,7H,4,6H2,1-3H3,(H,12,13).
What are the key properties of 2-tert-butyl-5,6-dihydro-1H-pyrrolo[2,3-b]pyridine?
2-tert-butyl-5,6-dihydro-1H-pyrrolo[2,3-b]pyridine has a molecular weight of 176.26 g/mol, XLogP of 1.12, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-5,6-dihydro-1H-pyrrolo[2,3-b]pyridine is sourced from PubChem (CID 89000850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).