C10H15NO — CID 89000911
(3S)-3-amino-2,5-dimethylocta-5,6,7-trien-4-one (PubChem CID 89000911) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is (3S)-3-amino-2,5-dimethylocta-5,6,7-trien-4-one.
| Compound Name | (3S)-3-amino-2,5-dimethylocta-5,6,7-trien-4-one |
|---|---|
| PubChem CID | 89000911 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | (3S)-3-amino-2,5-dimethylocta-5,6,7-trien-4-one |
| SMILES | C=C=C=C(C)C(=O)[C@@H](N)C(C)C |
| InChI | InChI=1S/C10H15NO/c1-5-6-8(4)10(12)9(11)7(2)3/h7,9H,1,11H2,2-4H3/t9-/m0/s1 |
| InChIKey | SUQPSBBKBTXDHF-VIFPVBQESA-N |
| XLogP | 1.43 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|