C36H35N — CID 89001014
2-[10-[4-(3,4,4a,5-tetrahydronaphthalen-2-yl)cyclohexa-1,3-dien-1-yl]-2,3-dihydroanthracen-9-yl]-6-methyl-3,4-dihydropyridine (PubChem CID 89001014) has the molecular formula C36H35N and a molecular weight of 481.68 g/mol. Its IUPAC name is 2-[10-[4-(3,4,4a,5-tetrahydronaphthalen-2-yl)cyclohexa-1,3-dien-1-yl]-2,3-dihydroanthracen-9-yl]-6-methyl-3,4-dihydropyridine.
| Compound Name | 2-[10-[4-(3,4,4a,5-tetrahydronaphthalen-2-yl)cyclohexa-1,3-dien-1-yl]-2,3-dihydroanthracen-9-yl]-6-methyl-3,4-dihydropyridine |
|---|---|
| PubChem CID | 89001014 |
| Molecular Formula | C36H35N |
| Molecular Weight | 481.68 g/mol |
| Exact Mass | 481.28 |
| IUPAC Name | 2-[10-[4-(3,4,4a,5-tetrahydronaphthalen-2-yl)cyclohexa-1,3-dien-1-yl]-2,3-dihydroanthracen-9-yl]-6-methyl-3,4-dihydropyridine |
| SMILES | CC1=CCCC(c2c3c(c(C4=CC=C(C5=CC6=CC=CCC6CC5)CC4)c4ccccc24)=CCCC=3)=N1 |
| InChI | InChI=1S/C36H35N/c1-24-9-8-16-34(37-24)36-32-14-6-4-12-30(32)35(31-13-5-7-15-33(31)36)27-20-17-26(18-21-27)29-22-19-25-10-2-3-11-28(25)23-29/h2-4,6,9,11-15,17,20,23,25H,5,7-8,10,16,18-19,21-22H2,1H3 |
| InChIKey | PWPVNXVZKCOVHE-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.68 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |