C29H44N2 — CID 89001138
1-N,2-N-dimethyl-3-[(2E,4E)-5,6,6-trimethylhepta-2,4-dien-2-yl]-6-[(2E,4E)-5,6,6-trimethylocta-2,4-dien-2-yl]cyclohexa-3,5-diene-1,2-diimine (PubChem CID 89001138) has the molecular formula C29H44N2 and a molecular weight of 420.69 g/mol. Its IUPAC name is 1-N,2-N-dimethyl-3-[(2E,4E)-5,6,6-trimethylhepta-2,4-dien-2-yl]-6-[(2E,4E)-5,6,6-trimethylocta-2,4-dien-2-yl]cyclohexa-3,5-diene-1,2-diimine.
| Compound Name | 1-N,2-N-dimethyl-3-[(2E,4E)-5,6,6-trimethylhepta-2,4-dien-2-yl]-6-[(2E,4E)-5,6,6-trimethylocta-2,4-dien-2-yl]cyclohexa-3,5-diene-1,2-diimine |
|---|---|
| PubChem CID | 89001138 |
| Molecular Formula | C29H44N2 |
| Molecular Weight | 420.69 g/mol |
| Exact Mass | 420.35 |
| IUPAC Name | 1-N,2-N-dimethyl-3-[(2E,4E)-5,6,6-trimethylhepta-2,4-dien-2-yl]-6-[(2E,4E)-5,6,6-trimethylocta-2,4-dien-2-yl]cyclohexa-3,5-diene-1,2-diimine |
| SMILES | CCC(C)(C)/C(C)=C/C=C(\C)C1=CC=C(/C(C)=C/C=C(\C)C(C)(C)C)C(=N\C)/C1=N\C |
| InChI | InChI=1S/C29H44N2/c1-13-29(9,10)23(5)17-15-21(3)25-19-18-24(26(30-11)27(25)31-12)20(2)14-16-22(4)28(6,7)8/h14-19H,13H2,1-12H3/b20-14+,21-15+,22-16+,23-17+,30-26+,31-27- |
| InChIKey | NIXXHNPLDJCDRW-WSDOECIXSA-N |
| XLogP | 8.26 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.69 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|