C34H33BrN2 — CID 89001335
3-[3-[5-(3-bromocyclohexa-1,3-dien-1-yl)-3-[5-(3,4-dihydropyridin-5-yl)cyclohexa-2,4-dien-1-yl]cyclohexa-2,4-dien-1-yl]phenyl]-1,2-dihydropyridine (PubChem CID 89001335) has the molecular formula C34H33BrN2 and a molecular weight of 549.56 g/mol. Its IUPAC name is 3-[3-[5-(3-bromocyclohexa-1,3-dien-1-yl)-3-[5-(3,4-dihydropyridin-5-yl)cyclohexa-2,4-dien-1-yl]cyclohexa-2,4-dien-1-yl]phenyl]-1,2-dihydropyridine.
| Compound Name | 3-[3-[5-(3-bromocyclohexa-1,3-dien-1-yl)-3-[5-(3,4-dihydropyridin-5-yl)cyclohexa-2,4-dien-1-yl]cyclohexa-2,4-dien-1-yl]phenyl]-1,2-dihydropyridine |
|---|---|
| PubChem CID | 89001335 |
| Molecular Formula | C34H33BrN2 |
| Molecular Weight | 549.56 g/mol |
| Exact Mass | 548.18 |
| IUPAC Name | 3-[3-[5-(3-bromocyclohexa-1,3-dien-1-yl)-3-[5-(3,4-dihydropyridin-5-yl)cyclohexa-2,4-dien-1-yl]cyclohexa-2,4-dien-1-yl]phenyl]-1,2-dihydropyridine |
| SMILES | BrC1=CCCC(C2=CC(C3C=CC=C(C4=CN=CCC4)C3)=CC(c3cccc(C4=CC=CNC4)c3)C2)=C1 |
| InChI | InChI=1S/C34H33BrN2/c35-34-13-3-10-28(21-34)33-19-31(26-8-1-6-24(16-26)29-11-4-14-36-22-29)18-32(20-33)27-9-2-7-25(17-27)30-12-5-15-37-23-30/h1-2,4,6-9,11,13-16,18,20-21,23,27,31,36H,3,5,10,12,17,19,22H2 |
| InChIKey | ZALKNWXTLZAOND-UHFFFAOYSA-N |
| XLogP | 8.78 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.56 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |