C34H38ClN3O5S2 — CID 89001369
2-[2-[[(2S)-2-hydroxy-2-phenylethyl]-methylcarbamoyl]oxyethyldisulfanyl]ethyl 4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidine-1-carboxylate (PubChem CID 89001369) has the molecular formula C34H38ClN3O5S2 and a molecular weight of 668.28 g/mol. Its IUPAC name is 2-[2-[[(2S)-2-hydroxy-2-phenylethyl]-methylcarbamoyl]oxyethyldisulfanyl]ethyl 4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidine-1-carboxylate.
| Compound Name | 2-[2-[[(2S)-2-hydroxy-2-phenylethyl]-methylcarbamoyl]oxyethyldisulfanyl]ethyl 4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 89001369 |
| Molecular Formula | C34H38ClN3O5S2 |
| Molecular Weight | 668.28 g/mol |
| Exact Mass | 667.19 |
| IUPAC Name | 2-[2-[[(2S)-2-hydroxy-2-phenylethyl]-methylcarbamoyl]oxyethyldisulfanyl]ethyl 4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidine-1-carboxylate |
| SMILES | CN(C[C@@H](O)c1ccccc1)C(=O)OCCSSCCOC(=O)N1CCC(=C2c3ccc(Cl)cc3CCc3cccnc32)CC1 |
| InChI | InChI=1S/C34H38ClN3O5S2/c1-37(23-30(39)24-6-3-2-4-7-24)33(40)42-18-20-44-45-21-19-43-34(41)38-16-13-25(14-17-38)31-29-12-11-28(35)22-27(29)10-9-26-8-5-15-36-32(26)31/h2-8,11-12,15,22,30,39H,9-10,13-14,16-21,23H2,1H3/t30-/m1/s1 |
| InChIKey | GBPAPVHMNJWSSI-SSEXGKCCSA-N |
| XLogP | 7.05 |
| TPSA | 92.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.28 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|