C23H25F2N3O3 — CID 89001431
2-amino-4-[4-(difluoromethoxy)phenyl]-4-[3-[(E)-6-methoxyhex-1-enyl]phenyl]-1H-imidazol-5-one (PubChem CID 89001431) has the molecular formula C23H25F2N3O3 and a molecular weight of 429.47 g/mol. Its IUPAC name is 2-amino-4-[4-(difluoromethoxy)phenyl]-4-[3-[(E)-6-methoxyhex-1-enyl]phenyl]-1H-imidazol-5-one.
| Compound Name | 2-amino-4-[4-(difluoromethoxy)phenyl]-4-[3-[(E)-6-methoxyhex-1-enyl]phenyl]-1H-imidazol-5-one |
|---|---|
| PubChem CID | 89001431 |
| Molecular Formula | C23H25F2N3O3 |
| Molecular Weight | 429.47 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | 2-amino-4-[4-(difluoromethoxy)phenyl]-4-[3-[(E)-6-methoxyhex-1-enyl]phenyl]-1H-imidazol-5-one |
| SMILES | COCCCC/C=C/c1cccc(C2(c3ccc(OC(F)F)cc3)N=C(N)NC2=O)c1 |
| InChI | InChI=1S/C23H25F2N3O3/c1-30-14-5-3-2-4-7-16-8-6-9-18(15-16)23(20(29)27-22(26)28-23)17-10-12-19(13-11-17)31-21(24)25/h4,6-13,15,21H,2-3,5,14H2,1H3,(H3,26,27,28,29)/b7-4+ |
| InChIKey | PBKPXOFVZUDAJR-QPJJXVBHSA-N |
| XLogP | 3.81 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.47 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|