About (1S)-1-cyclohexa-2,4-dien-1-yl-2-(methylamino)ethanol
(1S)-1-cyclohexa-2,4-dien-1-yl-2-(methylamino)ethanol (PubChem CID 89001496) has the molecular formula C9H15NO
and a molecular weight of 153.22 g/mol. Its IUPAC name is (1S)-1-cyclohexa-2,4-dien-1-yl-2-(methylamino)ethanol.
Molecular Properties
| Compound Name | (1S)-1-cyclohexa-2,4-dien-1-yl-2-(methylamino)ethanol |
| PubChem CID | 89001496 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | (1S)-1-cyclohexa-2,4-dien-1-yl-2-(methylamino)ethanol |
| SMILES | CNC[C@@H](O)C1C=CC=CC1 |
| InChI | InChI=1S/C9H15NO/c1-10-7-9(11)8-5-3-2-4-6-8/h2-5,8-11H,6-7H2,1H3/t8?,9-/m1/s1 |
| InChIKey | JTQMJBCCXQHJBL-YGPZHTELSA-N |
| XLogP | 0.70 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1S)-1-cyclohexa-2,4-dien-1-yl-2-(methylamino)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1-cyclohexa-2,4-dien-1-yl-2-(methylamino)ethanol?
The IUPAC name of (1S)-1-cyclohexa-2,4-dien-1-yl-2-(methylamino)ethanol (CID 89001496) is (1S)-1-cyclohexa-2,4-dien-1-yl-2-(methylamino)ethanol.
What is the SMILES notation for (1S)-1-cyclohexa-2,4-dien-1-yl-2-(methylamino)ethanol?
The canonical SMILES for (1S)-1-cyclohexa-2,4-dien-1-yl-2-(methylamino)ethanol is CNC[C@@H](O)C1C=CC=CC1.
What is the InChIKey of (1S)-1-cyclohexa-2,4-dien-1-yl-2-(methylamino)ethanol?
The InChIKey is JTQMJBCCXQHJBL-YGPZHTELSA-N. The full InChI is InChI=1S/C9H15NO/c1-10-7-9(11)8-5-3-2-4-6-8/h2-5,8-11H,6-7H2,1H3/t8?,9-/m1/s1.
What are the key properties of (1S)-1-cyclohexa-2,4-dien-1-yl-2-(methylamino)ethanol?
(1S)-1-cyclohexa-2,4-dien-1-yl-2-(methylamino)ethanol has a molecular weight of 153.22 g/mol, XLogP of 0.70, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1-cyclohexa-2,4-dien-1-yl-2-(methylamino)ethanol is sourced from PubChem (CID 89001496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).