C31H65NO2 — CID 89001621
N-[3-(3-methoxy-3-methylbutoxy)-3-methylbutyl]-4,4,6,6-tetramethyl-2-(2,2,4,4-tetramethylpentyl)heptan-1-amine (PubChem CID 89001621) has the molecular formula C31H65NO2 and a molecular weight of 483.87 g/mol. Its IUPAC name is N-[3-(3-methoxy-3-methylbutoxy)-3-methylbutyl]-4,4,6,6-tetramethyl-2-(2,2,4,4-tetramethylpentyl)heptan-1-amine.
| Compound Name | N-[3-(3-methoxy-3-methylbutoxy)-3-methylbutyl]-4,4,6,6-tetramethyl-2-(2,2,4,4-tetramethylpentyl)heptan-1-amine |
|---|---|
| PubChem CID | 89001621 |
| Molecular Formula | C31H65NO2 |
| Molecular Weight | 483.87 g/mol |
| Exact Mass | 483.50 |
| IUPAC Name | N-[3-(3-methoxy-3-methylbutoxy)-3-methylbutyl]-4,4,6,6-tetramethyl-2-(2,2,4,4-tetramethylpentyl)heptan-1-amine |
| SMILES | COC(C)(C)CCOC(C)(C)CCNCC(CC(C)(C)CC(C)(C)C)CC(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C31H65NO2/c1-26(2,3)23-28(7,8)20-25(21-29(9,10)24-27(4,5)6)22-32-18-16-31(13,14)34-19-17-30(11,12)33-15/h25,32H,16-24H2,1-15H3 |
| InChIKey | GKPSITFEYLPWSA-UHFFFAOYSA-N |
| XLogP | 8.90 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.87 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|