C21H45NO — CID 89001623
4,4,6,6-tetramethyl-N-[3-methyl-3-(3-methylbutoxy)butyl]heptan-1-amine (PubChem CID 89001623) has the molecular formula C21H45NO and a molecular weight of 327.60 g/mol. Its IUPAC name is 4,4,6,6-tetramethyl-N-[3-methyl-3-(3-methylbutoxy)butyl]heptan-1-amine.
| Compound Name | 4,4,6,6-tetramethyl-N-[3-methyl-3-(3-methylbutoxy)butyl]heptan-1-amine |
|---|---|
| PubChem CID | 89001623 |
| Molecular Formula | C21H45NO |
| Molecular Weight | 327.60 g/mol |
| Exact Mass | 327.35 |
| IUPAC Name | 4,4,6,6-tetramethyl-N-[3-methyl-3-(3-methylbutoxy)butyl]heptan-1-amine |
| SMILES | CC(C)CCOC(C)(C)CCNCCCC(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C21H45NO/c1-18(2)11-16-23-21(8,9)13-15-22-14-10-12-20(6,7)17-19(3,4)5/h18,22H,10-17H2,1-9H3 |
| InChIKey | JQMFFGUHLQNCIG-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.60 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|