About propyl [ethyl(methyl)-λ3-iodanyl]formate
propyl [ethyl(methyl)-λ3-iodanyl]formate (PubChem CID 89001635) has the molecular formula C7H15IO2
and a molecular weight of 258.10 g/mol. Its IUPAC name is propyl [ethyl(methyl)-λ3-iodanyl]formate.
Molecular Properties
| Compound Name | propyl [ethyl(methyl)-λ3-iodanyl]formate |
| PubChem CID | 89001635 |
| Molecular Formula | C7H15IO2 |
| Molecular Weight | 258.10 g/mol |
| Exact Mass | 258.01 |
| IUPAC Name | propyl [ethyl(methyl)-λ3-iodanyl]formate |
| SMILES | CCCOC(=O)I(C)CC |
| InChI | InChI=1S/C7H15IO2/c1-4-6-10-7(9)8(3)5-2/h4-6H2,1-3H3 |
| InChIKey | WQFZDHPGHZYFBI-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.10 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze propyl [ethyl(methyl)-λ3-iodanyl]formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propyl [ethyl(methyl)-λ3-iodanyl]formate?
The IUPAC name of propyl [ethyl(methyl)-λ3-iodanyl]formate (CID 89001635) is propyl [ethyl(methyl)-λ3-iodanyl]formate.
What is the SMILES notation for propyl [ethyl(methyl)-λ3-iodanyl]formate?
The canonical SMILES for propyl [ethyl(methyl)-λ3-iodanyl]formate is CCCOC(=O)I(C)CC.
What is the InChIKey of propyl [ethyl(methyl)-λ3-iodanyl]formate?
The InChIKey is WQFZDHPGHZYFBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15IO2/c1-4-6-10-7(9)8(3)5-2/h4-6H2,1-3H3.
What are the key properties of propyl [ethyl(methyl)-λ3-iodanyl]formate?
propyl [ethyl(methyl)-λ3-iodanyl]formate has a molecular weight of 258.10 g/mol, XLogP of 2.69, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for propyl [ethyl(methyl)-λ3-iodanyl]formate is sourced from PubChem (CID 89001635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).