C18H29NO2 — CID 89001655
N-[(2Z,4Z)-hepta-2,4,6-trienyl]-2-(methoxymethyl)-4-methyl-2-propan-2-ylpent-3-enamide (PubChem CID 89001655) has the molecular formula C18H29NO2 and a molecular weight of 291.44 g/mol. Its IUPAC name is N-[(2Z,4Z)-hepta-2,4,6-trienyl]-2-(methoxymethyl)-4-methyl-2-propan-2-ylpent-3-enamide.
| Compound Name | N-[(2Z,4Z)-hepta-2,4,6-trienyl]-2-(methoxymethyl)-4-methyl-2-propan-2-ylpent-3-enamide |
|---|---|
| PubChem CID | 89001655 |
| Molecular Formula | C18H29NO2 |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.22 |
| IUPAC Name | N-[(2Z,4Z)-hepta-2,4,6-trienyl]-2-(methoxymethyl)-4-methyl-2-propan-2-ylpent-3-enamide |
| SMILES | C=C/C=C\C=C/CNC(=O)C(C=C(C)C)(COC)C(C)C |
| InChI | InChI=1S/C18H29NO2/c1-7-8-9-10-11-12-19-17(20)18(14-21-6,16(4)5)13-15(2)3/h7-11,13,16H,1,12,14H2,2-6H3,(H,19,20)/b9-8-,11-10- |
| InChIKey | HQZUJZSQISFVAF-XESWYYRISA-N |
| XLogP | 3.66 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|